Citric Acid
eMolecules 253174-92-4 | Medchem Express | BMS-262084 | 5mg | 779534504 | HY-118969 | 425.49 | C18H31N7O5
Medchem Express | Schisandrin B | 10mg | 446274590 | HY-N0089 | 61281-37-6 | MFCD00210555 | 400.471 | C23H28O6
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Medchemexpress LLC Citric acid triammonium | 3458-72-8 | 99.9% | 50 G
Citric acid triammonium is formed by citric acid reacting with ammonia in a molar ratio of 1:3. It can be used as a carbon source to prepare carbon quantum dots (CDs). Higher nitrogen components in citric acid triammonium may promote nitrogen-based functional groups in CDs, leading to more efficient emission-color tunability.
- Used as a carbon source for carbon quantum dots
- Promotes nitrogen-based functional groups in CDs
- Leads to efficient emission-color tunability
- Human endogenous metabolite
Hach Company Citric Acid Powder Pillows for Silica, 25 mL, pk/1000
For silica determination by photometric methods. Sample Size: 25 mL Pack of 100 powder pillows.
Sigma Aldrich Fine Chemicals Biosciences Citric acid natural 99.5 f1KG
Citric acid natural 99.5 f1KG
eMolecules 2938997-47-6 | 3-tert-Butoxycarbonylamino-cycloheptanecarboxylic acid | J&W PharmLab LLC257.330 | C13H23NO4 | 95.000 | CC(C)(C)OC(=O)NC1CCCCC(C1)C(O)=O | 500mg | 794066949
3-tert-Butoxycarbonylamino-cycloheptanecarboxylic acid | J&W PharmLab LLC | 2938997-47-6257.330 | C13H23NO4 | 95.000 | CC(C)(C)OC(=O)NC1CCCCC(C1)C(O)=O | 500mg | 794066949
eMolecules Medchem Express | AS-99 (TFA) | 5mg | 673359019 | HY-141429A | 707.71 | C29H31F6N5O5S2
Medchem Express | AS-99 (TFA) | 5mg | 673359019 | HY-141429A | | 707.710 | C29H31F6N5O5S2
eMolecules 77-92-9 | Citric acid | Combi-Blocks192.123 | C6H8O7 | 97.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 5g | 357559095
Citric acid | Combi-Blocks | 77-92-9192.123 | C6H8O7 | 97.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 5g | 357559095
![eMolecules 1001907-64-7 | 5,8-dioxaspiro[3.4]octane-2-carboxylic acid | Pharmablock | MFCD11036133 | 158.153 | C7H10O4 | 97.000 | OC(=O)C1CC2(C1)OCCO2 | 100mg | 551087913](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502517848.JPG-250.jpg)
eMolecules 1001907-64-7 | 5,8-dioxaspiro[3.4]octane-2-carboxylic acid | Pharmablock | MFCD11036133 | 158.153 | C7H10O4 | 97.000 | OC(=O)C1CC2(C1)OCCO2 | 100mg | 551087913
5,8-dioxaspiro[3.4]octane-2-carboxylic acid | Pharmablock | 1001907-64-7 | MFCD11036133 | 158.153 | C7H10O4 | 97.000 | OC(=O)C1CC2(C1)OCCO2 | 100mg | 551087913
Medchemexpress LLC Dimethyl Citric acid | 53798-97-3 | ≥97.0% | 220.18 | 100 MG
Dimethyl Citric acid is a highly efficient deep eutectic solvent (DES) that serves as both a catalyst and a green reaction medium. It is suitable for the synthesis of various compounds, including bis(indolyl)methanes, quinolines, and aryl-4, 5-diphenyl-1H-imidazoles.
- Highly efficient deep eutectic solvent (DES)
- Functions as a catalyst
- Acts as a green reaction medium
- Used for synthesizing bis(indolyl)methanes
- Used for synthesizing quinolines
- Used for synthesizing aryl-4, 5-diphenyl-1H-imidazoles
Medchemexpress LLC Citric acid (monohydrate) | 5949-29-1 | CB3235573 | 210.14 | 5 G
Citric acid monohydrate is a natural preservative, food tartness enhancer, and an acidulant, emulsifier, sequestrant, and buffering agent. It induces apoptosis and cell cycle arrest in HaCaT cells, and can cause oxidative damage of the liver and renal toxicity in mice in research.
- Natural preservative and food tartness enhancer
- Acidulant, emulsifier, sequestrant, and buffering agent
- Induces apoptosis and cell cycle arrest at G2/M and S phases
- Can cause oxidative damage of the liver by decreasing antioxidative enzyme activities
- Inhibits cell viability in a dose-dependent manner
- Increases expression of various apoptotic proteins and decreases anti-apoptotic proteins
OCC1c2ccccc2-c2ccccc12)c1ccccc1 | 500mg | 773119689](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502478785.JPG-250.jpg)
eMolecules 2323068-36-4 | (S)-4-(9H-Fluoren-9-ylmethoxycarbonylamino)-4-phenyl-butyric acid | J&W PharmLab LLC401.462 | C25H23NO4 | 96.000 | OC(=O)CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc12)c1ccccc1 | 500mg | 773119689
(S)-4-(9H-Fluoren-9-ylmethoxycarbonylamino)-4-phenyl-butyric acid | J&W PharmLab LLC | 2323068-36-4401.462 | C25H23NO4 | 96.000 | OC(=O)CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc12)c1ccccc1 | 500mg | 773119689
C(O)=O | 0.1g | 786474858](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502473170.JPG-250.jpg)
eMolecules 2349518-36-9 | (S)-2-((TERT-BUTOXYCARBONYL)AMINO)-5-(PYRIDIN-3-YL)PENTANOIC ACID | AstaTech294.351 | C15H22N2O4 | 95.000 | CC(C)(C)OC(=O)N[C@@H](CCCc1cccnc1)C(O)=O | 0.1g | 786474858
(S)-2-((TERT-BUTOXYCARBONYL)AMINO)-5-(PYRIDIN-3-YL)PENTANOIC ACID | AstaTech | 2349518-36-9294.351 | C15H22N2O4 | 95.000 | CC(C)(C)OC(=O)N[C@@H](CCCc1cccnc1)C(O)=O | 0.1g | 786474858